C21H30O4 — CID 15204678
methyl (3aR,12E,15aR)-12-methyl-9-methylidene-3,6-dioxo-2,4,5,7,8,10,11,14,15,15a-decahydro-1H-cyclopenta[14]annulene-3a-carboxylate (PubChem CID 15204678) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (3aR,12E,15aR)-12-methyl-9-methylidene-3,6-dioxo-2,4,5,7,8,10,11,14,15,15a-decahydro-1H-cyclopenta[14]annulene-3a-carboxylate.
| Compound Name | methyl (3aR,12E,15aR)-12-methyl-9-methylidene-3,6-dioxo-2,4,5,7,8,10,11,14,15,15a-decahydro-1H-cyclopenta[14]annulene-3a-carboxylate |
|---|---|
| PubChem CID | 15204678 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (3aR,12E,15aR)-12-methyl-9-methylidene-3,6-dioxo-2,4,5,7,8,10,11,14,15,15a-decahydro-1H-cyclopenta[14]annulene-3a-carboxylate |
| SMILES | C=C1CCC(=O)CC[C@]2(C(=O)OC)C(=O)CC[C@H]2CC/C=C(\C)CC1 |
| InChI | InChI=1S/C21H30O4/c1-15-5-4-6-17-10-12-19(23)21(17,20(24)25-3)14-13-18(22)11-9-16(2)8-7-15/h5,17H,2,4,6-14H2,1,3H3/b15-5+/t17-,21-/m1/s1 |
| InChIKey | KDSYHHPECNIRFX-PCXBAVSSSA-N |
| XLogP | 4.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|