C20H36N4 — CID 15204753
N'-[7-(5-aminopentylimino)-4-propan-2-ylcyclohepta-1,3,5-trien-1-yl]pentane-1,5-diamine (PubChem CID 15204753) has the molecular formula C20H36N4 and a molecular weight of 332.54 g/mol. Its IUPAC name is N'-[7-(5-aminopentylimino)-4-propan-2-ylcyclohepta-1,3,5-trien-1-yl]pentane-1,5-diamine.
| Compound Name | N'-[7-(5-aminopentylimino)-4-propan-2-ylcyclohepta-1,3,5-trien-1-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 15204753 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | N'-[7-(5-aminopentylimino)-4-propan-2-ylcyclohepta-1,3,5-trien-1-yl]pentane-1,5-diamine |
| SMILES | CC(C)c1ccc(NCCCCCN)/c(=N/CCCCCN)cc1 |
| InChI | InChI=1S/C20H36N4/c1-17(2)18-9-11-19(23-15-7-3-5-13-21)20(12-10-18)24-16-8-4-6-14-22/h9-12,17H,3-8,13-16,21-22H2,1-2H3,(H,23,24) |
| InChIKey | LPCLMPBRWWVUKS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|