C31H29NO6 — CID 15204805
dimethyl 5-[3-(2-methylprop-2-enoyloxy)propyl]spiro[8aH-indolizine-1,9'-fluorene]-2,3-dicarboxylate (PubChem CID 15204805) has the molecular formula C31H29NO6 and a molecular weight of 511.57 g/mol. Its IUPAC name is dimethyl 5-[3-(2-methylprop-2-enoyloxy)propyl]spiro[8aH-indolizine-1,9'-fluorene]-2,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-(2-methylprop-2-enoyloxy)propyl]spiro[8aH-indolizine-1,9'-fluorene]-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15204805 |
| Molecular Formula | C31H29NO6 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | dimethyl 5-[3-(2-methylprop-2-enoyloxy)propyl]spiro[8aH-indolizine-1,9'-fluorene]-2,3-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCCC1=CC=CC2N1C(C(=O)OC)=C(C(=O)OC)C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H29NO6/c1-19(2)28(33)38-18-10-12-20-11-9-17-25-31(26(29(34)36-3)27(32(20)25)30(35)37-4)23-15-7-5-13-21(23)22-14-6-8-16-24(22)31/h5-9,11,13-17,25H,1,10,12,18H2,2-4H3 |
| InChIKey | AHFLWCBWABNEAV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|