About 2-(1,3-dioxolan-2-yl)-1,3-thiazole
2-(1,3-dioxolan-2-yl)-1,3-thiazole (PubChem CID 15205158) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-yl)-1,3-thiazole |
| PubChem CID | 15205158 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1,3-thiazole |
| SMILES | c1csc(C2OCCO2)n1 |
| InChI | InChI=1S/C6H7NO2S/c1-4-10-5(7-1)6-8-2-3-9-6/h1,4,6H,2-3H2 |
| InChIKey | OIRJZETZODTGOD-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dioxolan-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-yl)-1,3-thiazole?
The IUPAC name of 2-(1,3-dioxolan-2-yl)-1,3-thiazole (CID 15205158) is 2-(1,3-dioxolan-2-yl)-1,3-thiazole.
What is the SMILES notation for 2-(1,3-dioxolan-2-yl)-1,3-thiazole?
The canonical SMILES for 2-(1,3-dioxolan-2-yl)-1,3-thiazole is c1csc(C2OCCO2)n1.
What is the InChIKey of 2-(1,3-dioxolan-2-yl)-1,3-thiazole?
The InChIKey is OIRJZETZODTGOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-4-10-5(7-1)6-8-2-3-9-6/h1,4,6H,2-3H2.
What are the key properties of 2-(1,3-dioxolan-2-yl)-1,3-thiazole?
2-(1,3-dioxolan-2-yl)-1,3-thiazole has a molecular weight of 157.19 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-yl)-1,3-thiazole is sourced from PubChem (CID 15205158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).