C22H18N2O3 — CID 15205892
[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-phenylmethanone (PubChem CID 15205892) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is [4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 15205892 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-nitrophenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(N2CCc3ccccc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N2O3/c25-22(17-7-2-1-3-8-17)18-10-11-20(21(14-18)24(26)27)23-13-12-16-6-4-5-9-19(16)15-23/h1-11,14H,12-13,15H2 |
| InChIKey | RSIUDFBXQORSHI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|