C7H11NO2 — CID 15206009
3-propan-2-yl-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 15206009) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-propan-2-yl-2,3-dihydro-1,4-oxazin-6-one.
| Compound Name | 3-propan-2-yl-2,3-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 15206009 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-propan-2-yl-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | CC(C)C1COC(=O)C=N1 |
| InChI | InChI=1S/C7H11NO2/c1-5(2)6-4-10-7(9)3-8-6/h3,5-6H,4H2,1-2H3 |
| InChIKey | YVTZVXQOBFCVQQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |