C16H18N4O2 — CID 15207366
2-(2-adamantylamino)-5-nitropyridine-3-carbonitrile (PubChem CID 15207366) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(2-adamantylamino)-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-(2-adamantylamino)-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 15207366 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-(2-adamantylamino)-5-nitropyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H18N4O2/c17-7-13-6-14(20(21)22)8-18-16(13)19-15-11-2-9-1-10(4-11)5-12(15)3-9/h6,8-12,15H,1-5H2,(H,18,19) |
| InChIKey | RVRJAFUTGFABJF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|