C17H26O3 — CID 15207420
5,7,8-trimethyl-2,4-di(propan-2-yl)-4H-1,3-benzodioxin-6-ol (PubChem CID 15207420) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 5,7,8-trimethyl-2,4-di(propan-2-yl)-4H-1,3-benzodioxin-6-ol.
| Compound Name | 5,7,8-trimethyl-2,4-di(propan-2-yl)-4H-1,3-benzodioxin-6-ol |
|---|---|
| PubChem CID | 15207420 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 5,7,8-trimethyl-2,4-di(propan-2-yl)-4H-1,3-benzodioxin-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(C(C)C)OC(C(C)C)O2 |
| InChI | InChI=1S/C17H26O3/c1-8(2)15-13-12(7)14(18)10(5)11(6)16(13)20-17(19-15)9(3)4/h8-9,15,17-18H,1-7H3 |
| InChIKey | DAKLXLQABCBQGP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |