About 9-octylcarbazol-2-ol
9-octylcarbazol-2-ol (PubChem CID 15208713) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is 9-octylcarbazol-2-ol.
Molecular Properties
| Compound Name | 9-octylcarbazol-2-ol |
| PubChem CID | 15208713 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 9-octylcarbazol-2-ol |
| SMILES | CCCCCCCCn1c2ccccc2c2ccc(O)cc21 |
| InChI | InChI=1S/C20H25NO/c1-2-3-4-5-6-9-14-21-19-11-8-7-10-17(19)18-13-12-16(22)15-20(18)21/h7-8,10-13,15,22H,2-6,9,14H2,1H3 |
| InChIKey | YKLDNHOPFKEADH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-octylcarbazol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-octylcarbazol-2-ol?
The IUPAC name of 9-octylcarbazol-2-ol (CID 15208713) is 9-octylcarbazol-2-ol.
What is the SMILES notation for 9-octylcarbazol-2-ol?
The canonical SMILES for 9-octylcarbazol-2-ol is CCCCCCCCn1c2ccccc2c2ccc(O)cc21.
What is the InChIKey of 9-octylcarbazol-2-ol?
The InChIKey is YKLDNHOPFKEADH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO/c1-2-3-4-5-6-9-14-21-19-11-8-7-10-17(19)18-13-12-16(22)15-20(18)21/h7-8,10-13,15,22H,2-6,9,14H2,1H3.
What are the key properties of 9-octylcarbazol-2-ol?
9-octylcarbazol-2-ol has a molecular weight of 295.43 g/mol, XLogP of 5.86, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-octylcarbazol-2-ol is sourced from PubChem (CID 15208713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).