C21H13ClN4 — CID 15209204
5-amino-7-chloro-2,4-diphenyl-1,6-naphthyridine-8-carbonitrile (PubChem CID 15209204) has the molecular formula C21H13ClN4 and a molecular weight of 356.82 g/mol. Its IUPAC name is 5-amino-7-chloro-2,4-diphenyl-1,6-naphthyridine-8-carbonitrile.
| Compound Name | 5-amino-7-chloro-2,4-diphenyl-1,6-naphthyridine-8-carbonitrile |
|---|---|
| PubChem CID | 15209204 |
| Molecular Formula | C21H13ClN4 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 5-amino-7-chloro-2,4-diphenyl-1,6-naphthyridine-8-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(N)c2c(-c3ccccc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H13ClN4/c22-20-16(12-23)19-18(21(24)26-20)15(13-7-3-1-4-8-13)11-17(25-19)14-9-5-2-6-10-14/h1-11H,(H2,24,26) |
| InChIKey | GZSLSTPIAZMVRY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|