About 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide
4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide (PubChem CID 15209953) has the molecular formula C16H21IN4O
and a molecular weight of 412.28 g/mol. Its IUPAC name is 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide.
Molecular Properties
| Compound Name | 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide |
| PubChem CID | 15209953 |
| Molecular Formula | C16H21IN4O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide |
| SMILES | CCC[n+]1cc(-c2ccccc2)nc(N2CCOCC2)n1.[I-] |
| InChI | InChI=1S/C16H21N4O.HI/c1-2-8-20-13-15(14-6-4-3-5-7-14)17-16(18-20)19-9-11-21-12-10-19;/h3-7,13H,2,8-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | MKWSQCRJDKHCSX-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The IUPAC name of 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide (CID 15209953) is 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide.
What is the SMILES notation for 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The canonical SMILES for 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide is CCC[n+]1cc(-c2ccccc2)nc(N2CCOCC2)n1.[I-].
What is the InChIKey of 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
The InChIKey is MKWSQCRJDKHCSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H21N4O.HI/c1-2-8-20-13-15(14-6-4-3-5-7-14)17-16(18-20)19-9-11-21-12-10-19;/h3-7,13H,2,8-12H2,1H3;1H/q+1;/p-1.
What are the key properties of 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide?
4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide has a molecular weight of 412.28 g/mol, XLogP of -1.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-phenyl-1-propyl-1,2,4-triazin-1-ium-3-yl)morpholine iodide is sourced from PubChem (CID 15209953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).