About N'-hexylacetohydrazide
N'-hexylacetohydrazide (PubChem CID 15210594) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is N'-hexylacetohydrazide.
Molecular Properties
| Compound Name | N'-hexylacetohydrazide |
| PubChem CID | 15210594 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-hexylacetohydrazide |
| SMILES | CCCCCCNNC(C)=O |
| InChI | InChI=1S/C8H18N2O/c1-3-4-5-6-7-9-10-8(2)11/h9H,3-7H2,1-2H3,(H,10,11) |
| InChIKey | XKYRVCJQADWQBH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hexylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexylacetohydrazide?
The IUPAC name of N'-hexylacetohydrazide (CID 15210594) is N'-hexylacetohydrazide.
What is the SMILES notation for N'-hexylacetohydrazide?
The canonical SMILES for N'-hexylacetohydrazide is CCCCCCNNC(C)=O.
What is the InChIKey of N'-hexylacetohydrazide?
The InChIKey is XKYRVCJQADWQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-4-5-6-7-9-10-8(2)11/h9H,3-7H2,1-2H3,(H,10,11).
What are the key properties of N'-hexylacetohydrazide?
N'-hexylacetohydrazide has a molecular weight of 158.25 g/mol, XLogP of 1.21, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexylacetohydrazide is sourced from PubChem (CID 15210594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).