C16H28O4 — CID 15210833
5-(2,2-dimethylpropanoyl)-7-methoxy-3,7-dimethyloctane-2,6-dione (PubChem CID 15210833) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoyl)-7-methoxy-3,7-dimethyloctane-2,6-dione.
| Compound Name | 5-(2,2-dimethylpropanoyl)-7-methoxy-3,7-dimethyloctane-2,6-dione |
|---|---|
| PubChem CID | 15210833 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 5-(2,2-dimethylpropanoyl)-7-methoxy-3,7-dimethyloctane-2,6-dione |
| SMILES | COC(C)(C)C(=O)C(CC(C)C(C)=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H28O4/c1-10(11(2)17)9-12(13(18)15(3,4)5)14(19)16(6,7)20-8/h10,12H,9H2,1-8H3 |
| InChIKey | MICTVMQWIVANEA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|