About 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran
2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran (PubChem CID 15211176) has the molecular formula C13H24OS2
and a molecular weight of 260.47 g/mol. Its IUPAC name is 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran |
| PubChem CID | 15211176 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran |
| SMILES | CCCCSC1=COC(SCCCC)CC1 |
| InChI | InChI=1S/C13H24OS2/c1-3-5-9-15-12-7-8-13(14-11-12)16-10-6-4-2/h11,13H,3-10H2,1-2H3 |
| InChIKey | ZSMNXJVZIDHETN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran?
The IUPAC name of 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran (CID 15211176) is 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran?
The canonical SMILES for 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran is CCCCSC1=COC(SCCCC)CC1.
What is the InChIKey of 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran?
The InChIKey is ZSMNXJVZIDHETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OS2/c1-3-5-9-15-12-7-8-13(14-11-12)16-10-6-4-2/h11,13H,3-10H2,1-2H3.
What are the key properties of 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran?
2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran has a molecular weight of 260.47 g/mol, XLogP of 5.03, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(butylsulfanyl)-3,4-dihydro-2H-pyran is sourced from PubChem (CID 15211176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).