About 3,4,5,6-tetraphenylpyridazine
3,4,5,6-tetraphenylpyridazine (PubChem CID 15212125) has the molecular formula C28H20N2
and a molecular weight of 384.48 g/mol. Its IUPAC name is 3,4,5,6-tetraphenylpyridazine.
Molecular Properties
| Compound Name | 3,4,5,6-tetraphenylpyridazine |
| PubChem CID | 15212125 |
| Molecular Formula | C28H20N2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3,4,5,6-tetraphenylpyridazine |
| SMILES | c1ccc(-c2nnc(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H20N2/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)30-29-27(25)23-17-9-3-10-18-23/h1-20H |
| InChIKey | CLCAGGCUZYIOCF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4,5,6-tetraphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5,6-tetraphenylpyridazine?
The IUPAC name of 3,4,5,6-tetraphenylpyridazine (CID 15212125) is 3,4,5,6-tetraphenylpyridazine.
What is the SMILES notation for 3,4,5,6-tetraphenylpyridazine?
The canonical SMILES for 3,4,5,6-tetraphenylpyridazine is c1ccc(-c2nnc(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 3,4,5,6-tetraphenylpyridazine?
The InChIKey is CLCAGGCUZYIOCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20N2/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)30-29-27(25)23-17-9-3-10-18-23/h1-20H.
What are the key properties of 3,4,5,6-tetraphenylpyridazine?
3,4,5,6-tetraphenylpyridazine has a molecular weight of 384.48 g/mol, XLogP of 7.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5,6-tetraphenylpyridazine is sourced from PubChem (CID 15212125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).