About 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene
2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene (PubChem CID 15212684) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene.
Analyze 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene?
The IUPAC name of 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene (CID 15212684) is 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene.
What is the SMILES notation for 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene?
The canonical SMILES for 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene is c1ccc2c(c1)C1CCC2N2CCCCC12.
What is the InChIKey of 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene?
The InChIKey is XUWUJNGIAHFEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c1-2-6-12-11(5-1)13-8-9-15(12)16-10-4-3-7-14(13)16/h1-2,5-6,13-15H,3-4,7-10H2.
What are the key properties of 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene?
2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene has a molecular weight of 213.32 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13-triene is sourced from PubChem (CID 15212684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).