C19H25N — CID 15212685
2-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13-triene (PubChem CID 15212685) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13-triene.
| Compound Name | 2-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13-triene |
|---|---|
| PubChem CID | 15212685 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-azapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13-triene |
| SMILES | c1ccc2c(c1)C1C3CCCCC3C2N2CCCCC12 |
| InChI | InChI=1S/C19H25N/c1-3-9-15-13(7-1)18-14-8-2-4-10-16(14)19(15)20-12-6-5-11-17(18)20/h1,3,7,9,14,16-19H,2,4-6,8,10-12H2 |
| InChIKey | QEJMRCZGZHIZSC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |