C13H18O6 — CID 15212765
(1R,2R,6S,7S,8S,9R)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 15212765) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,9R)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid.
| Compound Name | (1R,2R,6S,7S,8S,9R)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 15212765 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1R,2R,6S,7S,8S,9R)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]([C@@H]3OC(C)(C)O[C@H]23)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H18O6/c1-13(2)18-9-5-4-6(10(9)19-13)8(12(16)17-3)7(5)11(14)15/h5-10H,4H2,1-3H3,(H,14,15)/t5-,6+,7-,8+,9-,10+/m0/s1 |
| InChIKey | PRHPMARBZUIEJT-AZVNGCGHSA-N |
| XLogP | 0.65 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |