C10H14O4 — CID 15212973
(1E,5E)-1,6-diethoxyhexa-1,5-diene-3,4-dione (PubChem CID 15212973) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (1E,5E)-1,6-diethoxyhexa-1,5-diene-3,4-dione.
| Compound Name | (1E,5E)-1,6-diethoxyhexa-1,5-diene-3,4-dione |
|---|---|
| PubChem CID | 15212973 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1E,5E)-1,6-diethoxyhexa-1,5-diene-3,4-dione |
| SMILES | CCO/C=C/C(=O)C(=O)/C=C/OCC |
| InChI | InChI=1S/C10H14O4/c1-3-13-7-5-9(11)10(12)6-8-14-4-2/h5-8H,3-4H2,1-2H3/b7-5+,8-6+ |
| InChIKey | LLVBFQQQPHLOKU-KQQUZDAGSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|