About 1-azatricyclo[3.3.1.13,7]decane-4-thione
1-azatricyclo[3.3.1.13,7]decane-4-thione (PubChem CID 15214080) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 1-azatricyclo[3.3.1.13,7]decane-4-thione.
Molecular Properties
| Compound Name | 1-azatricyclo[3.3.1.13,7]decane-4-thione |
| PubChem CID | 15214080 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 1-azatricyclo[3.3.1.13,7]decane-4-thione |
| SMILES | S=C1C2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C9H13NS/c11-9-7-1-6-2-8(9)5-10(3-6)4-7/h6-8H,1-5H2 |
| InChIKey | PUGXKIMNTVSRSB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-azatricyclo[3.3.1.13,7]decane-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[3.3.1.13,7]decane-4-thione?
The IUPAC name of 1-azatricyclo[3.3.1.13,7]decane-4-thione (CID 15214080) is 1-azatricyclo[3.3.1.13,7]decane-4-thione.
What is the SMILES notation for 1-azatricyclo[3.3.1.13,7]decane-4-thione?
The canonical SMILES for 1-azatricyclo[3.3.1.13,7]decane-4-thione is S=C1C2CC3CC1CN(C3)C2.
What is the InChIKey of 1-azatricyclo[3.3.1.13,7]decane-4-thione?
The InChIKey is PUGXKIMNTVSRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c11-9-7-1-6-2-8(9)5-10(3-6)4-7/h6-8H,1-5H2.
What are the key properties of 1-azatricyclo[3.3.1.13,7]decane-4-thione?
1-azatricyclo[3.3.1.13,7]decane-4-thione has a molecular weight of 167.28 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[3.3.1.13,7]decane-4-thione is sourced from PubChem (CID 15214080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).