C29H32O4 — CID 15214364
1-(6-tert-butyl-2-hydroxynaphthalen-1-yl)-3-(2-ethoxyethoxymethyl)naphthalen-2-ol (PubChem CID 15214364) has the molecular formula C29H32O4 and a molecular weight of 444.57 g/mol. Its IUPAC name is 1-(6-tert-butyl-2-hydroxynaphthalen-1-yl)-3-(2-ethoxyethoxymethyl)naphthalen-2-ol.
| Compound Name | 1-(6-tert-butyl-2-hydroxynaphthalen-1-yl)-3-(2-ethoxyethoxymethyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 15214364 |
| Molecular Formula | C29H32O4 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-(6-tert-butyl-2-hydroxynaphthalen-1-yl)-3-(2-ethoxyethoxymethyl)naphthalen-2-ol |
| SMILES | CCOCCOCc1cc2ccccc2c(-c2c(O)ccc3cc(C(C)(C)C)ccc23)c1O |
| InChI | InChI=1S/C29H32O4/c1-5-32-14-15-33-18-21-16-19-8-6-7-9-23(19)27(28(21)31)26-24-12-11-22(29(2,3)4)17-20(24)10-13-25(26)30/h6-13,16-17,30-31H,5,14-15,18H2,1-4H3 |
| InChIKey | WLAYZYMOQJDBRY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|