C12H8O2Se — CID 15215632
2-phenylselanylcyclohexa-2,5-diene-1,4-dione (PubChem CID 15215632) has the molecular formula C12H8O2Se and a molecular weight of 263.15 g/mol. Its IUPAC name is 2-phenylselanylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-phenylselanylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15215632 |
| Molecular Formula | C12H8O2Se |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-phenylselanylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C([Se]c2ccccc2)=C1 |
| InChI | InChI=1S/C12H8O2Se/c13-9-6-7-11(14)12(8-9)15-10-4-2-1-3-5-10/h1-8H |
| InChIKey | NZJXLYQYADDVPA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|