C42H43FN5O7P — CID 15216886
N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro-[(2-methylpropan-2-yl)oxy]phosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 15216886) has the molecular formula C42H43FN5O7P and a molecular weight of 779.81 g/mol. Its IUPAC name is N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro-[(2-methylpropan-2-yl)oxy]phosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro-[(2-methylpropan-2-yl)oxy]phosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 15216886 |
| Molecular Formula | C42H43FN5O7P |
| Molecular Weight | 779.81 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | N-[9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[fluoro-[(2-methylpropan-2-yl)oxy]phosphanyl]oxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C[C@@H]2OP(F)OC(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H43FN5O7P/c1-41(2,3)55-56(43)54-34-24-36(48-27-46-37-38(44-26-45-39(37)48)47-40(49)28-12-8-6-9-13-28)53-35(34)25-52-42(29-14-10-7-11-15-29,30-16-20-32(50-4)21-17-30)31-18-22-33(51-5)23-19-31/h6-23,26-27,34-36H,24-25H2,1-5H3,(H,44,45,47,49)/t34-,35+,36+,56?/m0/s1 |
| InChIKey | HGMIPCAFNSTLML-MICLYWDSSA-N |
| XLogP | 8.79 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.81 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|