C31H22N2O6 — CID 15217129
5-[4-[2-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione (PubChem CID 15217129) has the molecular formula C31H22N2O6 and a molecular weight of 518.53 g/mol. Its IUPAC name is 5-[4-[2-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione.
| Compound Name | 5-[4-[2-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15217129 |
| Molecular Formula | C31H22N2O6 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 5-[4-[2-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]isoindole-1,3-dione |
| SMILES | CC(C)(c1ccc(Oc2ccc3c(c2)C(=O)NC3=O)cc1)c1ccc(Oc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C31H22N2O6/c1-31(2,17-3-7-19(8-4-17)38-21-11-13-23-25(15-21)29(36)32-27(23)34)18-5-9-20(10-6-18)39-22-12-14-24-26(16-22)30(37)33-28(24)35/h3-16H,1-2H3,(H,32,34,36)(H,33,35,37) |
| InChIKey | SJDXMURNFNZJFA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|