About 6-chloro-2-methyl-1,3-benzotellurazole
6-chloro-2-methyl-1,3-benzotellurazole (PubChem CID 15217544) has the molecular formula C8H6ClNTe
and a molecular weight of 279.20 g/mol. Its IUPAC name is 6-chloro-2-methyl-1,3-benzotellurazole.
Molecular Properties
| Compound Name | 6-chloro-2-methyl-1,3-benzotellurazole |
| PubChem CID | 15217544 |
| Molecular Formula | C8H6ClNTe |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | 6-chloro-2-methyl-1,3-benzotellurazole |
| SMILES | Cc1nc2ccc(Cl)cc2[te]1 |
| InChI | InChI=1S/C8H6ClNTe/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3 |
| InChIKey | KNSZUGPUNCBRQB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-methyl-1,3-benzotellurazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methyl-1,3-benzotellurazole?
The IUPAC name of 6-chloro-2-methyl-1,3-benzotellurazole (CID 15217544) is 6-chloro-2-methyl-1,3-benzotellurazole.
What is the SMILES notation for 6-chloro-2-methyl-1,3-benzotellurazole?
The canonical SMILES for 6-chloro-2-methyl-1,3-benzotellurazole is Cc1nc2ccc(Cl)cc2[te]1.
What is the InChIKey of 6-chloro-2-methyl-1,3-benzotellurazole?
The InChIKey is KNSZUGPUNCBRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNTe/c1-5-10-7-3-2-6(9)4-8(7)11-5/h2-4H,1H3.
What are the key properties of 6-chloro-2-methyl-1,3-benzotellurazole?
6-chloro-2-methyl-1,3-benzotellurazole has a molecular weight of 279.20 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methyl-1,3-benzotellurazole is sourced from PubChem (CID 15217544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).