C23H27NO6S — CID 15218070
2-methoxyethyl (2R,4aR,7R,8S,8aR)-7-hydroxy-2-phenyl-8-phenylsulfanyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 15218070) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-methoxyethyl (2R,4aR,7R,8S,8aR)-7-hydroxy-2-phenyl-8-phenylsulfanyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | 2-methoxyethyl (2R,4aR,7R,8S,8aR)-7-hydroxy-2-phenyl-8-phenylsulfanyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 15218070 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-methoxyethyl (2R,4aR,7R,8S,8aR)-7-hydroxy-2-phenyl-8-phenylsulfanyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | COCCOC(=O)N1C[C@@H](O)[C@H](Sc2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@H]21 |
| InChI | InChI=1S/C23H27NO6S/c1-27-12-13-28-23(26)24-14-19(25)21(31-17-10-6-3-7-11-17)20-18(24)15-29-22(30-20)16-8-4-2-5-9-16/h2-11,18-22,25H,12-15H2,1H3/t18-,19-,20-,21+,22-/m1/s1 |
| InChIKey | LJJAZRMSYFZWEA-CSEOROSGSA-N |
| XLogP | 3.09 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|