C10H23NO4Si — CID 15218073
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-(trimethylsilylmethyl)piperidine-3,4,5-triol (PubChem CID 15218073) has the molecular formula C10H23NO4Si and a molecular weight of 249.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-(trimethylsilylmethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-(trimethylsilylmethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 15218073 |
| Molecular Formula | C10H23NO4Si |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-(trimethylsilylmethyl)piperidine-3,4,5-triol |
| SMILES | C[Si](C)(C)CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C10H23NO4Si/c1-16(2,3)6-11-4-8(13)10(15)9(14)7(11)5-12/h7-10,12-15H,4-6H2,1-3H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | SVTIPKXKXLLASX-UTINFBMNSA-N |
| XLogP | -1.38 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|