C45H84N8O4 — CID 15218745
2-[[4,6-bis[butyl-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol (PubChem CID 15218745) has the molecular formula C45H84N8O4 and a molecular weight of 801.22 g/mol. Its IUPAC name is 2-[[4,6-bis[butyl-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[[4,6-bis[butyl-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 15218745 |
| Molecular Formula | C45H84N8O4 |
| Molecular Weight | 801.22 g/mol |
| Exact Mass | 800.66 |
| IUPAC Name | 2-[[4,6-bis[butyl-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCN(c1nc(N(CCO)CCO)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C45H84N8O4/c1-11-13-25-50(35-31-42(3,4)52(43(5,6)32-35)56-37-21-17-15-18-22-37)40-46-39(49(27-29-54)28-30-55)47-41(48-40)51(26-14-12-2)36-33-44(7,8)53(45(9,10)34-36)57-38-23-19-16-20-24-38/h35-38,54-55H,11-34H2,1-10H3 |
| InChIKey | YSNHIFDTKFOOER-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.22 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |