About 1,1-dimethyl-2,2-dipropylhydrazine
1,1-dimethyl-2,2-dipropylhydrazine (PubChem CID 15219025) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 1,1-dimethyl-2,2-dipropylhydrazine.
Molecular Properties
| Compound Name | 1,1-dimethyl-2,2-dipropylhydrazine |
| PubChem CID | 15219025 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 1,1-dimethyl-2,2-dipropylhydrazine |
| SMILES | CCCN(CCC)N(C)C |
| InChI | InChI=1S/C8H20N2/c1-5-7-10(8-6-2)9(3)4/h5-8H2,1-4H3 |
| InChIKey | QMITVNOADSEAMB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2,2-dipropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2,2-dipropylhydrazine?
The IUPAC name of 1,1-dimethyl-2,2-dipropylhydrazine (CID 15219025) is 1,1-dimethyl-2,2-dipropylhydrazine.
What is the SMILES notation for 1,1-dimethyl-2,2-dipropylhydrazine?
The canonical SMILES for 1,1-dimethyl-2,2-dipropylhydrazine is CCCN(CCC)N(C)C.
What is the InChIKey of 1,1-dimethyl-2,2-dipropylhydrazine?
The InChIKey is QMITVNOADSEAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2/c1-5-7-10(8-6-2)9(3)4/h5-8H2,1-4H3.
What are the key properties of 1,1-dimethyl-2,2-dipropylhydrazine?
1,1-dimethyl-2,2-dipropylhydrazine has a molecular weight of 144.26 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2,2-dipropylhydrazine is sourced from PubChem (CID 15219025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).