C12H26O — CID 15219341
3,4,5,6,6-pentamethylheptan-2-ol (PubChem CID 15219341) has the molecular formula C12H26O and a molecular weight of 186.34 g/mol. Its IUPAC name is 3,4,5,6,6-pentamethylheptan-2-ol.
| Compound Name | 3,4,5,6,6-pentamethylheptan-2-ol |
|---|---|
| PubChem CID | 15219341 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 3,4,5,6,6-pentamethylheptan-2-ol |
| SMILES | CC(O)C(C)C(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O/c1-8(9(2)11(4)13)10(3)12(5,6)7/h8-11,13H,1-7H3 |
| InChIKey | XEFKRPWKRQTXDA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |