C18H17FN2O5 — CID 15219381
2-(4-ethoxy-7-fluoro-3-oxo-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione (PubChem CID 15219381) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is 2-(4-ethoxy-7-fluoro-3-oxo-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(4-ethoxy-7-fluoro-3-oxo-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15219381 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(4-ethoxy-7-fluoro-3-oxo-1,4-benzoxazin-6-yl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
| SMILES | CCON1C(=O)COc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C18H17FN2O5/c1-2-26-21-14-8-13(12(19)7-15(14)25-9-16(21)22)20-17(23)10-5-3-4-6-11(10)18(20)24/h7-8H,2-6,9H2,1H3 |
| InChIKey | ZBXPVSMORHJERP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|