C13H27NO4Si — CID 15221169
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(Z)-4-trimethylsilylbut-2-enyl]piperidine-3,4,5-triol (PubChem CID 15221169) has the molecular formula C13H27NO4Si and a molecular weight of 289.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(Z)-4-trimethylsilylbut-2-enyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(Z)-4-trimethylsilylbut-2-enyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 15221169 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[(Z)-4-trimethylsilylbut-2-enyl]piperidine-3,4,5-triol |
| SMILES | C[Si](C)(C)C/C=C\CN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C13H27NO4Si/c1-19(2,3)7-5-4-6-14-8-11(16)13(18)12(17)10(14)9-15/h4-5,10-13,15-18H,6-9H2,1-3H3/b5-4-/t10-,11+,12-,13-/m1/s1 |
| InChIKey | ROVHLDLBVVRKHH-MLBAOAEZSA-N |
| XLogP | -0.36 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|