C20H34F2O5 — CID 15222226
(3aR,4R,5R,6aS)-4-(4,4-difluoro-3-hydroxyoctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 15222226) has the molecular formula C20H34F2O5 and a molecular weight of 392.48 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-hydroxyoctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-hydroxyoctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 15222226 |
| Molecular Formula | C20H34F2O5 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(4,4-difluoro-3-hydroxyoctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCCC(F)(F)C(O)CC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H34F2O5/c1-2-3-9-20(21,22)17(23)8-7-13-14-11-18(24)26-16(14)12-15(13)27-19-6-4-5-10-25-19/h13-19,23-24H,2-12H2,1H3/t13-,14-,15-,16+,17?,18?,19?/m1/s1 |
| InChIKey | DWEOSWUWDHONKK-LKTMSYTBSA-N |
| XLogP | 3.61 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |