C21H32N2O — CID 15222437
(E)-3-(dimethylamino)-1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]prop-2-en-1-one (PubChem CID 15222437) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(dimethylamino)-1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 15222437 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (E)-3-(dimethylamino)-1-[7-(dipropylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]prop-2-en-1-one |
| SMILES | CCCN(CCC)C1CCc2cccc(C(=O)/C=C/N(C)C)c2C1 |
| InChI | InChI=1S/C21H32N2O/c1-5-13-23(14-6-2)18-11-10-17-8-7-9-19(20(17)16-18)21(24)12-15-22(3)4/h7-9,12,15,18H,5-6,10-11,13-14,16H2,1-4H3/b15-12+ |
| InChIKey | UFMRMTJBMIZXDB-NTCAYCPXSA-N |
| XLogP | 3.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|