About 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]
5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (PubChem CID 15222791) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
Molecular Properties
| Compound Name | 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| PubChem CID | 15222791 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] |
| SMILES | COc1cccc2c1CC1(CCCN1)CO2 |
| InChI | InChI=1S/C13H17NO2/c1-15-11-4-2-5-12-10(11)8-13(9-16-12)6-3-7-14-13/h2,4-5,14H,3,6-9H2,1H3 |
| InChIKey | KUXGHNDAHPGZBD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The IUPAC name of 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] (CID 15222791) is 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine].
What is the SMILES notation for 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The canonical SMILES for 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is COc1cccc2c1CC1(CCCN1)CO2.
What is the InChIKey of 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
The InChIKey is KUXGHNDAHPGZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-15-11-4-2-5-12-10(11)8-13(9-16-12)6-3-7-14-13/h2,4-5,14H,3,6-9H2,1H3.
What are the key properties of 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]?
5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] has a molecular weight of 219.28 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine] is sourced from PubChem (CID 15222791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).