C31H51NO5 — CID 15223416
[8-[7-(cyclohexylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 15223416) has the molecular formula C31H51NO5 and a molecular weight of 517.75 g/mol. Its IUPAC name is [8-[7-(cyclohexylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[7-(cyclohexylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 15223416 |
| Molecular Formula | C31H51NO5 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.38 |
| IUPAC Name | [8-[7-(cyclohexylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)NC3CCCCC3)C21 |
| InChI | InChI=1S/C31H51NO5/c1-6-31(4,5)30(36)37-27-17-20(2)16-22-13-12-21(3)26(29(22)27)15-14-24(33)18-25(34)19-28(35)32-23-10-8-7-9-11-23/h12-13,16,20-21,23-27,29,33-34H,6-11,14-15,17-19H2,1-5H3,(H,32,35) |
| InChIKey | NDJRQKHMWWVASB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |