C19H19Cl2NO3S — CID 15223430
(2S,3S)-8-chloro-5-(3-chloropropyl)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 15223430) has the molecular formula C19H19Cl2NO3S and a molecular weight of 412.34 g/mol. Its IUPAC name is (2S,3S)-8-chloro-5-(3-chloropropyl)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | (2S,3S)-8-chloro-5-(3-chloropropyl)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 15223430 |
| Molecular Formula | C19H19Cl2NO3S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (2S,3S)-8-chloro-5-(3-chloropropyl)-3-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | COc1ccc([C@@H]2Sc3cc(Cl)ccc3N(CCCCl)C(=O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H19Cl2NO3S/c1-25-14-6-3-12(4-7-14)18-17(23)19(24)22(10-2-9-20)15-8-5-13(21)11-16(15)26-18/h3-8,11,17-18,23H,2,9-10H2,1H3/t17-,18+/m1/s1 |
| InChIKey | AWAFHAPSKONDEQ-MSOLQXFVSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|