About (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal
(3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal (PubChem CID 15224148) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal.
Molecular Properties
| Compound Name | (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal |
| PubChem CID | 15224148 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal |
| SMILES | C[C@@H](CC=O)CCC[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3/c1-10(7-8-13)5-4-6-11-9-14-12(2,3)15-11/h8,10-11H,4-7,9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | ZVJRVYWSXRWTBO-GHMZBOCLSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal?
The IUPAC name of (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal (CID 15224148) is (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal.
What is the SMILES notation for (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal?
The canonical SMILES for (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal is C[C@@H](CC=O)CCC[C@@H]1COC(C)(C)O1.
What is the InChIKey of (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal?
The InChIKey is ZVJRVYWSXRWTBO-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H22O3/c1-10(7-8-13)5-4-6-11-9-14-12(2,3)15-11/h8,10-11H,4-7,9H2,1-3H3/t10-,11-/m1/s1.
What are the key properties of (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal?
(3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal has a molecular weight of 214.30 g/mol, XLogP of 2.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhexanal is sourced from PubChem (CID 15224148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).