C31H53FO8 — CID 15224614
methyl 5-fluoro-7-[(1R,2R,3R,5S)-2-(3-hydroxyoctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoate (PubChem CID 15224614) has the molecular formula C31H53FO8 and a molecular weight of 572.76 g/mol. Its IUPAC name is methyl 5-fluoro-7-[(1R,2R,3R,5S)-2-(3-hydroxyoctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoate.
| Compound Name | methyl 5-fluoro-7-[(1R,2R,3R,5S)-2-(3-hydroxyoctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoate |
|---|---|
| PubChem CID | 15224614 |
| Molecular Formula | C31H53FO8 |
| Molecular Weight | 572.76 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | methyl 5-fluoro-7-[(1R,2R,3R,5S)-2-(3-hydroxyoctyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]-6-oxoheptanoate |
| SMILES | CCCCCC(O)CC[C@@H]1[C@@H](CC(=O)C(F)CCCC(=O)OC)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C31H53FO8/c1-3-4-5-11-22(33)16-17-23-24(20-26(34)25(32)12-10-13-29(35)36-2)28(40-31-15-7-9-19-38-31)21-27(23)39-30-14-6-8-18-37-30/h22-25,27-28,30-31,33H,3-21H2,1-2H3/t22?,23-,24-,25?,27-,28+,30?,31?/m1/s1 |
| InChIKey | XIWOFSCCXIIGFL-UAAUQHFHSA-N |
| XLogP | 5.81 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|