C31H51FO8 — CID 15224615
methyl 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate (PubChem CID 15224615) has the molecular formula C31H51FO8 and a molecular weight of 570.74 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate |
|---|---|
| PubChem CID | 15224615 |
| Molecular Formula | C31H51FO8 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate |
| SMILES | CCCCCC(=O)CC[C@@H]1[C@@H](CC(=O)C(F)CCCC(=O)OC)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C31H51FO8/c1-3-4-5-11-22(33)16-17-23-24(20-26(34)25(32)12-10-13-29(35)36-2)28(40-31-15-7-9-19-38-31)21-27(23)39-30-14-6-8-18-37-30/h23-25,27-28,30-31H,3-21H2,1-2H3/t23-,24-,25?,27-,28+,30?,31?/m1/s1 |
| InChIKey | AYSQCGHOCPAPAH-HJVSYJIJSA-N |
| XLogP | 6.02 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|