C27H47FO6Si — CID 15224617
methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate (PubChem CID 15224617) has the molecular formula C27H47FO6Si and a molecular weight of 514.75 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate |
|---|---|
| PubChem CID | 15224617 |
| Molecular Formula | C27H47FO6Si |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-(3-oxooctyl)cyclopentyl]-5-fluoro-6-oxoheptanoate |
| SMILES | CCCCCC(=O)CC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1CC(=O)C(F)CCCC(=O)OC |
| InChI | InChI=1S/C27H47FO6Si/c1-8-9-10-12-19(29)15-16-20-21(17-24(31)22(28)13-11-14-26(32)33-5)23(30)18-25(20)34-35(6,7)27(2,3)4/h20-22,25H,8-18H2,1-7H3/t20-,21-,22?,25-/m1/s1 |
| InChIKey | JODWRNOVMXIKNI-VAQXQZKTSA-N |
| XLogP | 6.15 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|