C19H30O3 — CID 15226268
(3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butane-1,3-diol (PubChem CID 15226268) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butane-1,3-diol.
| Compound Name | (3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 15226268 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butane-1,3-diol |
| SMILES | C#CC[C@H]1O[C@@H]([C@](C)(O)CCO)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C19H30O3/c1-6-7-15-16-13(4)8-9-14(12(2)3)17(16)18(22-15)19(5,21)10-11-20/h1,8,12,14-18,20-21H,7,9-11H2,2-5H3/t14-,15-,16-,17-,18-,19-/m1/s1 |
| InChIKey | GTZOLAOOQHBKEX-MGYGNFHQSA-N |
| XLogP | 2.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|