C12H20O2 — CID 15226282
methyl (1S,5S)-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate (PubChem CID 15226282) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is methyl (1S,5S)-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 15226282 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | methyl (1S,5S)-2,5,6,6-tetramethylcyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(C)=CC[C@H](C)C1(C)C |
| InChI | InChI=1S/C12H20O2/c1-8-6-7-9(2)12(3,4)10(8)11(13)14-5/h6,9-10H,7H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | RVCUIJIDOUCODD-VHSXEESVSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|