C13H14N4S — CID 15226949
8-piperazin-1-yl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 15226949) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 8-piperazin-1-yl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-piperazin-1-yl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 15226949 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 8-piperazin-1-yl-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | c1cc2c(N3CCNCC3)nc3ccsc3n2c1 |
| InChI | InChI=1S/C13H14N4S/c1-2-11-12(16-7-4-14-5-8-16)15-10-3-9-18-13(10)17(11)6-1/h1-3,6,9,14H,4-5,7-8H2 |
| InChIKey | XYOILXJZQNPSEP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |