C19H20O4 — CID 15227437
(1R,4S,13R,16S)-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadeca-2(8),10-diene-6,9,15-trione (PubChem CID 15227437) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (1R,4S,13R,16S)-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadeca-2(8),10-diene-6,9,15-trione.
| Compound Name | (1R,4S,13R,16S)-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadeca-2(8),10-diene-6,9,15-trione |
|---|---|
| PubChem CID | 15227437 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (1R,4S,13R,16S)-11-methyl-4-prop-1-en-2-yl-14-oxatetracyclo[8.5.1.02,8.013,16]hexadeca-2(8),10-diene-6,9,15-trione |
| SMILES | C=C(C)[C@@H]1CC(=O)CC2=C(C1)[C@@H]1C(=O)O[C@@H]3CC(C)=C(C2=O)[C@H]13 |
| InChI | InChI=1S/C19H20O4/c1-8(2)10-5-11(20)7-13-12(6-10)16-17-14(23-19(16)22)4-9(3)15(17)18(13)21/h10,14,16-17H,1,4-7H2,2-3H3/t10-,14-,16+,17-/m1/s1 |
| InChIKey | BFJXMCOXWGLNFP-BFPUKSLXSA-N |
| XLogP | 2.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|