C21H26O5 — CID 15227504
(1S,2S,6S,7S,9R,13S,17S)-4-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione (PubChem CID 15227504) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1S,2S,6S,7S,9R,13S,17S)-4-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione.
| Compound Name | (1S,2S,6S,7S,9R,13S,17S)-4-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
|---|---|
| PubChem CID | 15227504 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,2S,6S,7S,9R,13S,17S)-4-methoxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-3,11,16-trione |
| SMILES | COC1=C[C@@H](C)[C@@H]2C[C@H]3OC(=O)C[C@H]4C(C)=CC(=O)[C@H]([C@@]2(C)C1=O)[C@@]34C |
| InChI | InChI=1S/C21H26O5/c1-10-6-14(22)18-20(3)13(10)9-17(23)26-16(20)8-12-11(2)7-15(25-5)19(24)21(12,18)4/h6-7,11-13,16,18H,8-9H2,1-5H3/t11-,12+,13+,16-,18+,20-,21+/m1/s1 |
| InChIKey | NONFZPSUEXXTLT-NXOGBDMJSA-N |
| XLogP | 2.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |