C19H31NO3 — CID 15228242
(6S)-6-[2-butoxyethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 15228242) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (6S)-6-[2-butoxyethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | (6S)-6-[2-butoxyethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 15228242 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (6S)-6-[2-butoxyethyl(propyl)amino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCCOCCN(CCC)[C@H]1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C19H31NO3/c1-3-5-12-23-13-11-20(10-4-2)16-7-8-17-15(14-16)6-9-18(21)19(17)22/h6,9,16,21-22H,3-5,7-8,10-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | DMBBWBZPACWIAG-INIZCTEOSA-N |
| XLogP | 3.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|