C44H36ClN9 — CID 15228251
3-[[3-chloro-2-[2-(2-trityltetrazol-5-yl)phenyl]indazol-5-yl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine (PubChem CID 15228251) has the molecular formula C44H36ClN9 and a molecular weight of 726.29 g/mol. Its IUPAC name is 3-[[3-chloro-2-[2-(2-trityltetrazol-5-yl)phenyl]indazol-5-yl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine.
| Compound Name | 3-[[3-chloro-2-[2-(2-trityltetrazol-5-yl)phenyl]indazol-5-yl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 15228251 |
| Molecular Formula | C44H36ClN9 |
| Molecular Weight | 726.29 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | 3-[[3-chloro-2-[2-(2-trityltetrazol-5-yl)phenyl]indazol-5-yl]methyl]-2-ethyl-5,7-dimethylimidazo[4,5-b]pyridine |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc2nn(-c3ccccc3-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c(Cl)c2c1 |
| InChI | InChI=1S/C44H36ClN9/c1-4-39-47-40-29(2)26-30(3)46-43(40)52(39)28-31-24-25-37-36(27-31)41(45)53(49-37)38-23-15-14-22-35(38)42-48-51-54(50-42)44(32-16-8-5-9-17-32,33-18-10-6-11-19-33)34-20-12-7-13-21-34/h5-27H,4,28H2,1-3H3 |
| InChIKey | INOPZVZMRYUBDC-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.29 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|