About (1-methylpiperidin-4-yl) N-methylcarbamate
(1-methylpiperidin-4-yl) N-methylcarbamate (PubChem CID 15229087) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) N-methylcarbamate |
| PubChem CID | 15229087 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (1-methylpiperidin-4-yl) N-methylcarbamate |
| SMILES | CNC(=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C8H16N2O2/c1-9-8(11)12-7-3-5-10(2)6-4-7/h7H,3-6H2,1-2H3,(H,9,11) |
| InChIKey | GGEZCLGZQVGHLJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) N-methylcarbamate?
The IUPAC name of (1-methylpiperidin-4-yl) N-methylcarbamate (CID 15229087) is (1-methylpiperidin-4-yl) N-methylcarbamate.
What is the SMILES notation for (1-methylpiperidin-4-yl) N-methylcarbamate?
The canonical SMILES for (1-methylpiperidin-4-yl) N-methylcarbamate is CNC(=O)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) N-methylcarbamate?
The InChIKey is GGEZCLGZQVGHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-9-8(11)12-7-3-5-10(2)6-4-7/h7H,3-6H2,1-2H3,(H,9,11).
What are the key properties of (1-methylpiperidin-4-yl) N-methylcarbamate?
(1-methylpiperidin-4-yl) N-methylcarbamate has a molecular weight of 172.23 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) N-methylcarbamate is sourced from PubChem (CID 15229087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).