About (1-methylpiperidin-4-yl) N-ethylcarbamate
(1-methylpiperidin-4-yl) N-ethylcarbamate (PubChem CID 15229088) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) N-ethylcarbamate |
| PubChem CID | 15229088 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1-methylpiperidin-4-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C9H18N2O2/c1-3-10-9(12)13-8-4-6-11(2)7-5-8/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | QKXFSMMZCCPUQJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) N-ethylcarbamate?
The IUPAC name of (1-methylpiperidin-4-yl) N-ethylcarbamate (CID 15229088) is (1-methylpiperidin-4-yl) N-ethylcarbamate.
What is the SMILES notation for (1-methylpiperidin-4-yl) N-ethylcarbamate?
The canonical SMILES for (1-methylpiperidin-4-yl) N-ethylcarbamate is CCNC(=O)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) N-ethylcarbamate?
The InChIKey is QKXFSMMZCCPUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-3-10-9(12)13-8-4-6-11(2)7-5-8/h8H,3-7H2,1-2H3,(H,10,12).
What are the key properties of (1-methylpiperidin-4-yl) N-ethylcarbamate?
(1-methylpiperidin-4-yl) N-ethylcarbamate has a molecular weight of 186.25 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) N-ethylcarbamate is sourced from PubChem (CID 15229088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).